C14H22N2OS — CID 143287437
ethane;N-(3-formyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-N'-methylmethanimidamide (PubChem CID 143287437) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is ethane;N-(3-formyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-N'-methylmethanimidamide.
| Compound Name | ethane;N-(3-formyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 143287437 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | ethane;N-(3-formyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-N'-methylmethanimidamide |
| SMILES | C/N=C/Nc1sc2c(c1C=O)CCCCC2.CC |
| InChI | InChI=1S/C12H16N2OS.C2H6/c1-13-8-14-12-10(7-15)9-5-3-2-4-6-11(9)16-12;1-2/h7-8H,2-6H2,1H3,(H,13,14);1-2H3 |
| InChIKey | OKMPRTVZCDGXNU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|