About 3-bromo-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbaldehyde
3-bromo-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbaldehyde (PubChem CID 71670902) has the molecular formula C8H7BrOS
and a molecular weight of 231.11 g/mol. Its IUPAC name is 3-bromo-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbaldehyde.
Molecular Properties
| Compound Name | 3-bromo-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbaldehyde |
| PubChem CID | 71670902 |
| Molecular Formula | C8H7BrOS |
| Molecular Weight | 231.11 g/mol |
| Exact Mass | 229.94 |
| IUPAC Name | 3-bromo-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbaldehyde |
| SMILES | O=Cc1sc2c(c1Br)CCC2 |
| InChI | InChI=1S/C8H7BrOS/c9-8-5-2-1-3-6(5)11-7(8)4-10/h4H,1-3H2 |
| InChIKey | NPAJRJKPTDQQBO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.11 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbaldehyde?
The IUPAC name of 3-bromo-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbaldehyde (CID 71670902) is 3-bromo-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbaldehyde.
What is the SMILES notation for 3-bromo-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbaldehyde?
The canonical SMILES for 3-bromo-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbaldehyde is O=Cc1sc2c(c1Br)CCC2.
What is the InChIKey of 3-bromo-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbaldehyde?
The InChIKey is NPAJRJKPTDQQBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrOS/c9-8-5-2-1-3-6(5)11-7(8)4-10/h4H,1-3H2.
What are the key properties of 3-bromo-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbaldehyde?
3-bromo-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbaldehyde has a molecular weight of 231.11 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbaldehyde is sourced from PubChem (CID 71670902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).