C27H24Cl2N2O4S — CID 143289085
2,6-dichloro-4-[4-[2-(4-ethenylphenyl)-5-methylsulfonylbenzoyl]piperazin-1-yl]benzaldehyde (PubChem CID 143289085) has the molecular formula C27H24Cl2N2O4S and a molecular weight of 543.47 g/mol. Its IUPAC name is 2,6-dichloro-4-[4-[2-(4-ethenylphenyl)-5-methylsulfonylbenzoyl]piperazin-1-yl]benzaldehyde.
| Compound Name | 2,6-dichloro-4-[4-[2-(4-ethenylphenyl)-5-methylsulfonylbenzoyl]piperazin-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 143289085 |
| Molecular Formula | C27H24Cl2N2O4S |
| Molecular Weight | 543.47 g/mol |
| Exact Mass | 542.08 |
| IUPAC Name | 2,6-dichloro-4-[4-[2-(4-ethenylphenyl)-5-methylsulfonylbenzoyl]piperazin-1-yl]benzaldehyde |
| SMILES | C=Cc1ccc(-c2ccc(S(C)(=O)=O)cc2C(=O)N2CCN(c3cc(Cl)c(C=O)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C27H24Cl2N2O4S/c1-3-18-4-6-19(7-5-18)22-9-8-21(36(2,34)35)16-23(22)27(33)31-12-10-30(11-13-31)20-14-25(28)24(17-32)26(29)15-20/h3-9,14-17H,1,10-13H2,2H3 |
| InChIKey | QGQVKSKCQJJLOX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|