C18H26N4 — CID 143289376
(Z,3Z)-6-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)-3-ethylidenehex-4-en-1-amine (PubChem CID 143289376) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is (Z,3Z)-6-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)-3-ethylidenehex-4-en-1-amine.
| Compound Name | (Z,3Z)-6-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)-3-ethylidenehex-4-en-1-amine |
|---|---|
| PubChem CID | 143289376 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | (Z,3Z)-6-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)-3-ethylidenehex-4-en-1-amine |
| SMILES | C/C=C(\C=C/Cn1c(CC)nc2c(C)cc(C)nc21)CCN |
| InChI | InChI=1S/C18H26N4/c1-5-15(9-10-19)8-7-11-22-16(6-2)21-17-13(3)12-14(4)20-18(17)22/h5,7-8,12H,6,9-11,19H2,1-4H3/b8-7-,15-5+ |
| InChIKey | UKRSIQZLGPDPHA-PXBUKJFOSA-N |
| XLogP | 3.46 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|