C26H52FNO3 — CID 143291289
methanol;methyl hypofluorite;18-[methyl(propyl)amino]icosa-18,19-dienal (PubChem CID 143291289) has the molecular formula C26H52FNO3 and a molecular weight of 445.70 g/mol. Its IUPAC name is methanol;methyl hypofluorite;18-[methyl(propyl)amino]icosa-18,19-dienal.
| Compound Name | methanol;methyl hypofluorite;18-[methyl(propyl)amino]icosa-18,19-dienal |
|---|---|
| PubChem CID | 143291289 |
| Molecular Formula | C26H52FNO3 |
| Molecular Weight | 445.70 g/mol |
| Exact Mass | 445.39 |
| IUPAC Name | methanol;methyl hypofluorite;18-[methyl(propyl)amino]icosa-18,19-dienal |
| SMILES | C=C=C(CCCCCCCCCCCCCCCCC=O)N(C)CCC.CO.COF |
| InChI | InChI=1S/C24H45NO.CH3FO.CH4O/c1-4-22-25(3)24(5-2)21-19-17-15-13-11-9-7-6-8-10-12-14-16-18-20-23-26;1-3-2;1-2/h23H,2,4,6-22H2,1,3H3;1H3;2H,1H3 |
| InChIKey | PDAZXUAJHRZJSL-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.70 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|