About 5-propan-2-ylhepta-5,6-dienal
5-propan-2-ylhepta-5,6-dienal (PubChem CID 125494928) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is 5-propan-2-ylhepta-5,6-dienal.
Molecular Properties
| Compound Name | 5-propan-2-ylhepta-5,6-dienal |
| PubChem CID | 125494928 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 5-propan-2-ylhepta-5,6-dienal |
| SMILES | C=C=C(CCCC=O)C(C)C |
| InChI | InChI=1S/C10H16O/c1-4-10(9(2)3)7-5-6-8-11/h8-9H,1,5-7H2,2-3H3 |
| InChIKey | SWHWPEPCNUOODT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-propan-2-ylhepta-5,6-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-ylhepta-5,6-dienal?
The IUPAC name of 5-propan-2-ylhepta-5,6-dienal (CID 125494928) is 5-propan-2-ylhepta-5,6-dienal.
What is the SMILES notation for 5-propan-2-ylhepta-5,6-dienal?
The canonical SMILES for 5-propan-2-ylhepta-5,6-dienal is C=C=C(CCCC=O)C(C)C.
What is the InChIKey of 5-propan-2-ylhepta-5,6-dienal?
The InChIKey is SWHWPEPCNUOODT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O/c1-4-10(9(2)3)7-5-6-8-11/h8-9H,1,5-7H2,2-3H3.
What are the key properties of 5-propan-2-ylhepta-5,6-dienal?
5-propan-2-ylhepta-5,6-dienal has a molecular weight of 152.24 g/mol, XLogP of 2.72, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-ylhepta-5,6-dienal is sourced from PubChem (CID 125494928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).