C14H18O2S — CID 143295560
(5Z)-6-methyl-1-(thiophen-3-ylmethoxy)octa-5,7-dien-2-one (PubChem CID 143295560) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is (5Z)-6-methyl-1-(thiophen-3-ylmethoxy)octa-5,7-dien-2-one.
| Compound Name | (5Z)-6-methyl-1-(thiophen-3-ylmethoxy)octa-5,7-dien-2-one |
|---|---|
| PubChem CID | 143295560 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (5Z)-6-methyl-1-(thiophen-3-ylmethoxy)octa-5,7-dien-2-one |
| SMILES | C=C/C(C)=C\CCC(=O)COCc1ccsc1 |
| InChI | InChI=1S/C14H18O2S/c1-3-12(2)5-4-6-14(15)10-16-9-13-7-8-17-11-13/h3,5,7-8,11H,1,4,6,9-10H2,2H3/b12-5- |
| InChIKey | LMPNEDUJAJAOLY-XGICHPGQSA-N |
| XLogP | 3.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|