About [difluoro(piperidin-4-yl)methyl]phosphane;6-ethylpyridin-2-amine
[difluoro(piperidin-4-yl)methyl]phosphane;6-ethylpyridin-2-amine (PubChem CID 143305027) has the molecular formula C13H22F2N3P
and a molecular weight of 289.31 g/mol. Its IUPAC name is [difluoro(piperidin-4-yl)methyl]phosphane;6-ethylpyridin-2-amine.
Molecular Properties
| Compound Name | [difluoro(piperidin-4-yl)methyl]phosphane;6-ethylpyridin-2-amine |
| PubChem CID | 143305027 |
| Molecular Formula | C13H22F2N3P |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | [difluoro(piperidin-4-yl)methyl]phosphane;6-ethylpyridin-2-amine |
| SMILES | CCc1cccc(N)n1.FC(F)(P)C1CCNCC1 |
| InChI | InChI=1S/C7H10N2.C6H12F2NP/c1-2-6-4-3-5-7(8)9-6;7-6(8,10)5-1-3-9-4-2-5/h3-5H,2H2,1H3,(H2,8,9);5,9H,1-4,10H2 |
| InChIKey | YJSRIHDBEOPLLI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [difluoro(piperidin-4-yl)methyl]phosphane;6-ethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [difluoro(piperidin-4-yl)methyl]phosphane;6-ethylpyridin-2-amine?
The IUPAC name of [difluoro(piperidin-4-yl)methyl]phosphane;6-ethylpyridin-2-amine (CID 143305027) is [difluoro(piperidin-4-yl)methyl]phosphane;6-ethylpyridin-2-amine.
What is the SMILES notation for [difluoro(piperidin-4-yl)methyl]phosphane;6-ethylpyridin-2-amine?
The canonical SMILES for [difluoro(piperidin-4-yl)methyl]phosphane;6-ethylpyridin-2-amine is CCc1cccc(N)n1.FC(F)(P)C1CCNCC1.
What is the InChIKey of [difluoro(piperidin-4-yl)methyl]phosphane;6-ethylpyridin-2-amine?
The InChIKey is YJSRIHDBEOPLLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C6H12F2NP/c1-2-6-4-3-5-7(8)9-6;7-6(8,10)5-1-3-9-4-2-5/h3-5H,2H2,1H3,(H2,8,9);5,9H,1-4,10H2.
What are the key properties of [difluoro(piperidin-4-yl)methyl]phosphane;6-ethylpyridin-2-amine?
[difluoro(piperidin-4-yl)methyl]phosphane;6-ethylpyridin-2-amine has a molecular weight of 289.31 g/mol, XLogP of 2.68, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [difluoro(piperidin-4-yl)methyl]phosphane;6-ethylpyridin-2-amine is sourced from PubChem (CID 143305027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).