C13H22F2N3P — CID 143305027
[difluoro(piperidin-4-yl)methyl]phosphane;6-ethylpyridin-2-amine (PubChem CID 143305027) has the molecular formula C13H22F2N3P and a molecular weight of 289.31 g/mol. Its IUPAC name is [difluoro(piperidin-4-yl)methyl]phosphane;6-ethylpyridin-2-amine.
| Compound Name | [difluoro(piperidin-4-yl)methyl]phosphane;6-ethylpyridin-2-amine |
|---|---|
| PubChem CID | 143305027 |
| Molecular Formula | C13H22F2N3P |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | [difluoro(piperidin-4-yl)methyl]phosphane;6-ethylpyridin-2-amine |
| SMILES | CCc1cccc(N)n1.FC(F)(P)C1CCNCC1 |
| InChI | InChI=1S/C7H10N2.C6H12F2NP/c1-2-6-4-3-5-7(8)9-6;7-6(8,10)5-1-3-9-4-2-5/h3-5H,2H2,1H3,(H2,8,9);5,9H,1-4,10H2 |
| InChIKey | YJSRIHDBEOPLLI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|