C10H11FInN — CID 143308565
6-fluoro-2,3,5-trimethyl-1,2-benzazaindigole (PubChem CID 143308565) has the molecular formula C10H11FInN and a molecular weight of 279.02 g/mol. Its IUPAC name is 6-fluoro-2,3,5-trimethyl-1,2-benzazaindigole.
| Compound Name | 6-fluoro-2,3,5-trimethyl-1,2-benzazaindigole |
|---|---|
| PubChem CID | 143308565 |
| Molecular Formula | C10H11FInN |
| Molecular Weight | 279.02 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 6-fluoro-2,3,5-trimethyl-1,2-benzazaindigole |
| SMILES | CC1=c2cc(C)c(F)cc2=N[In]1C |
| InChI | InChI=1S/C9H8FN.CH3.In/c1-3-7-4-6(2)8(10)5-9(7)11;;/h4-5H,1-2H3;1H3;/q-1;;+1 |
| InChIKey | BKXUKCAITMCXPY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.02 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |