C8H9NW — CID 20750403
1-cyclohexa-1,5-dien-1-ylethylideneazanide;tungsten(2+) (PubChem CID 20750403) has the molecular formula C8H9NW and a molecular weight of 303.01 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-ylethylideneazanide;tungsten(2+).
| Compound Name | 1-cyclohexa-1,5-dien-1-ylethylideneazanide;tungsten(2+) |
|---|---|
| PubChem CID | 20750403 |
| Molecular Formula | C8H9NW |
| Molecular Weight | 303.01 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-ylethylideneazanide;tungsten(2+) |
| SMILES | CC(=[N-])C1=[C-]CCC=C1.[W+2] |
| InChI | InChI=1S/C8H9N.W/c1-7(9)8-5-3-2-4-6-8;/h3,5H,2,4H2,1H3;/q-2;+2 |
| InChIKey | XYTMSMFGXDUOCB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 22.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.01 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|