C9H10N2Y-2 — CID 59950006
(6-azanidylidene-2,3,4-trimethylcyclohexa-2,4-dien-1-ylidene)azanide;yttrium (PubChem CID 59950006) has the molecular formula C9H10N2Y-2 and a molecular weight of 235.10 g/mol. Its IUPAC name is (6-azanidylidene-2,3,4-trimethylcyclohexa-2,4-dien-1-ylidene)azanide;yttrium.
| Compound Name | (6-azanidylidene-2,3,4-trimethylcyclohexa-2,4-dien-1-ylidene)azanide;yttrium |
|---|---|
| PubChem CID | 59950006 |
| Molecular Formula | C9H10N2Y-2 |
| Molecular Weight | 235.10 g/mol |
| Exact Mass | 234.99 |
| IUPAC Name | (6-azanidylidene-2,3,4-trimethylcyclohexa-2,4-dien-1-ylidene)azanide;yttrium |
| SMILES | CC1=CC(=[N-])C(=[N-])C(C)=C1C.[Y] |
| InChI | InChI=1S/C9H10N2.Y/c1-5-4-8(10)9(11)7(3)6(5)2;/h4H,1-3H3;/q-2; |
| InChIKey | KJKVZOSFIHYGIF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 44.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.10 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|