C28H47N3 — CID 143309257
2-[(3E)-4,6-dimethyl-3-(2-methylprop-1-enyl)octa-1,3-dien-2-yl]-1-[(3E,5Z)-trideca-1,3,5-trien-4-yl]guanidine (PubChem CID 143309257) has the molecular formula C28H47N3 and a molecular weight of 425.71 g/mol. Its IUPAC name is 2-[(3E)-4,6-dimethyl-3-(2-methylprop-1-enyl)octa-1,3-dien-2-yl]-1-[(3E,5Z)-trideca-1,3,5-trien-4-yl]guanidine.
| Compound Name | 2-[(3E)-4,6-dimethyl-3-(2-methylprop-1-enyl)octa-1,3-dien-2-yl]-1-[(3E,5Z)-trideca-1,3,5-trien-4-yl]guanidine |
|---|---|
| PubChem CID | 143309257 |
| Molecular Formula | C28H47N3 |
| Molecular Weight | 425.71 g/mol |
| Exact Mass | 425.38 |
| IUPAC Name | 2-[(3E)-4,6-dimethyl-3-(2-methylprop-1-enyl)octa-1,3-dien-2-yl]-1-[(3E,5Z)-trideca-1,3,5-trien-4-yl]guanidine |
| SMILES | C=C/C=C(\C=C/CCCCCCC)N/C(N)=N/C(=C)/C(C=C(C)C)=C(\C)CC(C)CC |
| InChI | InChI=1S/C28H47N3/c1-9-12-13-14-15-16-17-19-26(18-10-2)31-28(29)30-25(8)27(20-22(4)5)24(7)21-23(6)11-3/h10,17-20,23H,2,8-9,11-16,21H2,1,3-7H3,(H3,29,30,31)/b19-17-,26-18+,27-24+ |
| InChIKey | RFDMHUCDJZICMF-FBZBPYLGSA-N |
| XLogP | 8.11 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.71 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|