C16H21N — CID 143312340
N-[[2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]methyl]ethanamine (PubChem CID 143312340) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is N-[[2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]methyl]ethanamine.
| Compound Name | N-[[2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 143312340 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | N-[[2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]methyl]ethanamine |
| SMILES | C=C/C=C\C=C(/C)c1ccccc1CNCC |
| InChI | InChI=1S/C16H21N/c1-4-6-7-10-14(3)16-12-9-8-11-15(16)13-17-5-2/h4,6-12,17H,1,5,13H2,2-3H3/b7-6-,14-10+ |
| InChIKey | UOXKXLXYVQYILQ-KOORZVIOSA-N |
| XLogP | 3.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|