C24H26ClN5OS — CID 143313819
1-[4-[3-(4-chlorophenyl)-5-[4-(dimethylaminosulfanyl)piperazin-1-yl]pyrazin-2-yl]phenyl]ethanone (PubChem CID 143313819) has the molecular formula C24H26ClN5OS and a molecular weight of 468.03 g/mol. Its IUPAC name is 1-[4-[3-(4-chlorophenyl)-5-[4-(dimethylaminosulfanyl)piperazin-1-yl]pyrazin-2-yl]phenyl]ethanone.
| Compound Name | 1-[4-[3-(4-chlorophenyl)-5-[4-(dimethylaminosulfanyl)piperazin-1-yl]pyrazin-2-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 143313819 |
| Molecular Formula | C24H26ClN5OS |
| Molecular Weight | 468.03 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 1-[4-[3-(4-chlorophenyl)-5-[4-(dimethylaminosulfanyl)piperazin-1-yl]pyrazin-2-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(-c2ncc(N3CCN(SN(C)C)CC3)nc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H26ClN5OS/c1-17(31)18-4-6-19(7-5-18)23-24(20-8-10-21(25)11-9-20)27-22(16-26-23)29-12-14-30(15-13-29)32-28(2)3/h4-11,16H,12-15H2,1-3H3 |
| InChIKey | GOCFRDBOBXMKOE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.03 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|