C34H49NO4 — CID 143318215
acetylene;(1S,2S,7S)-7-[2-(hydroxymethoxy)propan-2-yl]-1,2-dimethyl-6-oxa-23-azahexacyclo[12.10.0.02,11.05,10.016,24.017,22]tetracosa-16(24),17,19,21-tetraen-12-ol;2-methylprop-1-ene (PubChem CID 143318215) has the molecular formula C34H49NO4 and a molecular weight of 535.77 g/mol. Its IUPAC name is acetylene;(1S,2S,7S)-7-[2-(hydroxymethoxy)propan-2-yl]-1,2-dimethyl-6-oxa-23-azahexacyclo[12.10.0.02,11.05,10.016,24.017,22]tetracosa-16(24),17,19,21-tetraen-12-ol;2-methylprop-1-ene.
| Compound Name | acetylene;(1S,2S,7S)-7-[2-(hydroxymethoxy)propan-2-yl]-1,2-dimethyl-6-oxa-23-azahexacyclo[12.10.0.02,11.05,10.016,24.017,22]tetracosa-16(24),17,19,21-tetraen-12-ol;2-methylprop-1-ene |
|---|---|
| PubChem CID | 143318215 |
| Molecular Formula | C34H49NO4 |
| Molecular Weight | 535.77 g/mol |
| Exact Mass | 535.37 |
| IUPAC Name | acetylene;(1S,2S,7S)-7-[2-(hydroxymethoxy)propan-2-yl]-1,2-dimethyl-6-oxa-23-azahexacyclo[12.10.0.02,11.05,10.016,24.017,22]tetracosa-16(24),17,19,21-tetraen-12-ol;2-methylprop-1-ene |
| SMILES | C#C.C=C(C)C.CC(C)(OCO)[C@@H]1CCC2C(CC[C@@]3(C)C2C(O)CC2Cc4c([nH]c5ccccc45)[C@@]23C)O1 |
| InChI | InChI=1S/C28H39NO4.C4H8.C2H2/c1-26(2,32-15-30)23-10-9-18-22(33-23)11-12-27(3)24(18)21(31)14-16-13-19-17-7-5-6-8-20(17)29-25(19)28(16,27)4;1-4(2)3;1-2/h5-8,16,18,21-24,29-31H,9-15H2,1-4H3;1H2,2-3H3;1-2H/t16?,18?,21?,22?,23-,24?,27-,28+;;/m0../s1 |
| InChIKey | MVJSYVPVTCCKDG-JLUHJQBRSA-N |
| XLogP | 6.52 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.77 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|