C28H39NO — CID 11960775
(1S,16S,20S)-1,16,20-trimethyl-16-(4-methylpent-3-enyl)-3-azapentacyclo[10.8.0.02,10.04,9.015,20]icosa-2(10),4,6,8-tetraen-17-ol (PubChem CID 11960775) has the molecular formula C28H39NO and a molecular weight of 405.63 g/mol. Its IUPAC name is (1S,16S,20S)-1,16,20-trimethyl-16-(4-methylpent-3-enyl)-3-azapentacyclo[10.8.0.02,10.04,9.015,20]icosa-2(10),4,6,8-tetraen-17-ol.
| Compound Name | (1S,16S,20S)-1,16,20-trimethyl-16-(4-methylpent-3-enyl)-3-azapentacyclo[10.8.0.02,10.04,9.015,20]icosa-2(10),4,6,8-tetraen-17-ol |
|---|---|
| PubChem CID | 11960775 |
| Molecular Formula | C28H39NO |
| Molecular Weight | 405.63 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | (1S,16S,20S)-1,16,20-trimethyl-16-(4-methylpent-3-enyl)-3-azapentacyclo[10.8.0.02,10.04,9.015,20]icosa-2(10),4,6,8-tetraen-17-ol |
| SMILES | CC(C)=CCC[C@]1(C)C(O)CC[C@@]2(C)C1CCC1Cc3c([nH]c4ccccc34)[C@@]12C |
| InChI | InChI=1S/C28H39NO/c1-18(2)9-8-15-26(3)23-13-12-19-17-21-20-10-6-7-11-22(20)29-25(21)28(19,5)27(23,4)16-14-24(26)30/h6-7,9-11,19,23-24,29-30H,8,12-17H2,1-5H3/t19?,23?,24?,26-,27-,28+/m0/s1 |
| InChIKey | XOLHQUYGSUGTQA-YRNJQXCPSA-N |
| XLogP | 6.92 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.63 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|