C24H31NO — CID 101253755
(1R,12R,13R,16S,17S,18R)-17-ethenyl-1,13,17-trimethyl-3-azapentacyclo[10.8.0.02,10.04,9.013,18]icosa-2(10),4,6,8-tetraen-16-ol (PubChem CID 101253755) has the molecular formula C24H31NO and a molecular weight of 349.52 g/mol. Its IUPAC name is (1R,12R,13R,16S,17S,18R)-17-ethenyl-1,13,17-trimethyl-3-azapentacyclo[10.8.0.02,10.04,9.013,18]icosa-2(10),4,6,8-tetraen-16-ol.
| Compound Name | (1R,12R,13R,16S,17S,18R)-17-ethenyl-1,13,17-trimethyl-3-azapentacyclo[10.8.0.02,10.04,9.013,18]icosa-2(10),4,6,8-tetraen-16-ol |
|---|---|
| PubChem CID | 101253755 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | (1R,12R,13R,16S,17S,18R)-17-ethenyl-1,13,17-trimethyl-3-azapentacyclo[10.8.0.02,10.04,9.013,18]icosa-2(10),4,6,8-tetraen-16-ol |
| SMILES | C=C[C@]1(C)[C@@H](O)CC[C@]2(C)[C@H]3Cc4c([nH]c5ccccc45)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C24H31NO/c1-5-22(2)18-10-12-24(4)19(23(18,3)13-11-20(22)26)14-16-15-8-6-7-9-17(15)25-21(16)24/h5-9,18-20,25-26H,1,10-14H2,2-4H3/t18-,19+,20-,22-,23-,24+/m0/s1 |
| InChIKey | LFDUNVUFEAHASN-MHLFWCDNSA-N |
| XLogP | 5.36 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|