C31H47NOSi — CID 134863647
(1S,12S,15R,16S,17S,20S)-3-[tert-butyl(dimethyl)silyl]-16-ethenyl-1,12,16,20-tetramethyl-3-azapentacyclo[10.8.0.02,10.04,9.015,20]icosa-2(10),4,6,8-tetraen-17-ol (PubChem CID 134863647) has the molecular formula C31H47NOSi and a molecular weight of 477.81 g/mol. Its IUPAC name is (1S,12S,15R,16S,17S,20S)-3-[tert-butyl(dimethyl)silyl]-16-ethenyl-1,12,16,20-tetramethyl-3-azapentacyclo[10.8.0.02,10.04,9.015,20]icosa-2(10),4,6,8-tetraen-17-ol.
| Compound Name | (1S,12S,15R,16S,17S,20S)-3-[tert-butyl(dimethyl)silyl]-16-ethenyl-1,12,16,20-tetramethyl-3-azapentacyclo[10.8.0.02,10.04,9.015,20]icosa-2(10),4,6,8-tetraen-17-ol |
|---|---|
| PubChem CID | 134863647 |
| Molecular Formula | C31H47NOSi |
| Molecular Weight | 477.81 g/mol |
| Exact Mass | 477.34 |
| IUPAC Name | (1S,12S,15R,16S,17S,20S)-3-[tert-butyl(dimethyl)silyl]-16-ethenyl-1,12,16,20-tetramethyl-3-azapentacyclo[10.8.0.02,10.04,9.015,20]icosa-2(10),4,6,8-tetraen-17-ol |
| SMILES | C=C[C@]1(C)[C@@H](O)CC[C@@]2(C)[C@H]1CC[C@@]1(C)Cc3c(n([Si](C)(C)C(C)(C)C)c4ccccc34)[C@@]12C |
| InChI | InChI=1S/C31H47NOSi/c1-11-29(6)24-16-18-28(5)20-22-21-14-12-13-15-23(21)32(34(9,10)27(2,3)4)26(22)31(28,8)30(24,7)19-17-25(29)33/h11-15,24-25,33H,1,16-20H2,2-10H3/t24-,25-,28-,29-,30-,31-/m0/s1 |
| InChIKey | GTCNAIPBLRCTBL-LPLFGQGVSA-N |
| XLogP | 8.08 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.81 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|