C27H35NO3 — CID 163040478
2-(1,2,8-trimethyl-6,10-dioxa-23-azaheptacyclo[12.10.0.02,12.05,11.09,11.016,24.017,22]tetracosa-16(24),17,19,21-tetraen-7-yl)propan-2-ol (PubChem CID 163040478) has the molecular formula C27H35NO3 and a molecular weight of 421.58 g/mol. Its IUPAC name is 2-(1,2,8-trimethyl-6,10-dioxa-23-azaheptacyclo[12.10.0.02,12.05,11.09,11.016,24.017,22]tetracosa-16(24),17,19,21-tetraen-7-yl)propan-2-ol.
| Compound Name | 2-(1,2,8-trimethyl-6,10-dioxa-23-azaheptacyclo[12.10.0.02,12.05,11.09,11.016,24.017,22]tetracosa-16(24),17,19,21-tetraen-7-yl)propan-2-ol |
|---|---|
| PubChem CID | 163040478 |
| Molecular Formula | C27H35NO3 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | 2-(1,2,8-trimethyl-6,10-dioxa-23-azaheptacyclo[12.10.0.02,12.05,11.09,11.016,24.017,22]tetracosa-16(24),17,19,21-tetraen-7-yl)propan-2-ol |
| SMILES | CC1C(C(C)(C)O)OC2CCC3(C)C(CC4Cc5c([nH]c6ccccc56)C43C)C23OC13 |
| InChI | InChI=1S/C27H35NO3/c1-14-22(24(2,3)29)30-20-10-11-25(4)19(27(20)23(14)31-27)13-15-12-17-16-8-6-7-9-18(16)28-21(17)26(15,25)5/h6-9,14-15,19-20,22-23,28-29H,10-13H2,1-5H3 |
| InChIKey | OLXSVMZYTCLUCL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|