C20H27NO — CID 143320100
7-ethyl-8-(2-ethylphenyl)-3,4-dihydro-2H-chromene;methanamine (PubChem CID 143320100) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is 7-ethyl-8-(2-ethylphenyl)-3,4-dihydro-2H-chromene;methanamine.
| Compound Name | 7-ethyl-8-(2-ethylphenyl)-3,4-dihydro-2H-chromene;methanamine |
|---|---|
| PubChem CID | 143320100 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 7-ethyl-8-(2-ethylphenyl)-3,4-dihydro-2H-chromene;methanamine |
| SMILES | CCc1ccccc1-c1c(CC)ccc2c1OCCC2.CN |
| InChI | InChI=1S/C19H22O.CH5N/c1-3-14-8-5-6-10-17(14)18-15(4-2)11-12-16-9-7-13-20-19(16)18;1-2/h5-6,8,10-12H,3-4,7,9,13H2,1-2H3;2H2,1H3 |
| InChIKey | JRBXFFQQIZYGLZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |