C13H23FO — CID 143320132
(3E)-5-fluoro-2-methyl-3-propan-2-yloxyhexa-1,3,5-triene;propane (PubChem CID 143320132) has the molecular formula C13H23FO and a molecular weight of 214.32 g/mol. Its IUPAC name is (3E)-5-fluoro-2-methyl-3-propan-2-yloxyhexa-1,3,5-triene;propane.
| Compound Name | (3E)-5-fluoro-2-methyl-3-propan-2-yloxyhexa-1,3,5-triene;propane |
|---|---|
| PubChem CID | 143320132 |
| Molecular Formula | C13H23FO |
| Molecular Weight | 214.32 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (3E)-5-fluoro-2-methyl-3-propan-2-yloxyhexa-1,3,5-triene;propane |
| SMILES | C=C(F)/C=C(/OC(C)C)C(=C)C.CCC |
| InChI | InChI=1S/C10H15FO.C3H8/c1-7(2)10(6-9(5)11)12-8(3)4;1-3-2/h6,8H,1,5H2,2-4H3;3H2,1-2H3/b10-6+; |
| InChIKey | XXIXVTZUNROWJO-AAGWESIMSA-N |
| XLogP | 4.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.32 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|