C35H49N3O4 — CID 143321756
5-N-cyclopropyl-3-N-[[9-(4-methoxybutyl)xanthen-9-yl]methyl]-1-methyl-5-N-(3-methylbutyl)piperidine-3,5-dicarboxamide (PubChem CID 143321756) has the molecular formula C35H49N3O4 and a molecular weight of 575.79 g/mol. Its IUPAC name is 5-N-cyclopropyl-3-N-[[9-(4-methoxybutyl)xanthen-9-yl]methyl]-1-methyl-5-N-(3-methylbutyl)piperidine-3,5-dicarboxamide.
| Compound Name | 5-N-cyclopropyl-3-N-[[9-(4-methoxybutyl)xanthen-9-yl]methyl]-1-methyl-5-N-(3-methylbutyl)piperidine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 143321756 |
| Molecular Formula | C35H49N3O4 |
| Molecular Weight | 575.79 g/mol |
| Exact Mass | 575.37 |
| IUPAC Name | 5-N-cyclopropyl-3-N-[[9-(4-methoxybutyl)xanthen-9-yl]methyl]-1-methyl-5-N-(3-methylbutyl)piperidine-3,5-dicarboxamide |
| SMILES | COCCCCC1(CNC(=O)C2CC(C(=O)N(CCC(C)C)C3CC3)CN(C)C2)c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C35H49N3O4/c1-25(2)17-19-38(28-15-16-28)34(40)27-21-26(22-37(3)23-27)33(39)36-24-35(18-9-10-20-41-4)29-11-5-7-13-31(29)42-32-14-8-6-12-30(32)35/h5-8,11-14,25-28H,9-10,15-24H2,1-4H3,(H,36,39) |
| InChIKey | CZUDDBMNNLQPFJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.79 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|