C27H38FN3O3 — CID 143321846
ethanamine;1-fluoro-N-[[9-(4-methoxybutyl)xanthen-9-yl]methyl]piperidine-3-carboxamide (PubChem CID 143321846) has the molecular formula C27H38FN3O3 and a molecular weight of 471.62 g/mol. Its IUPAC name is ethanamine;1-fluoro-N-[[9-(4-methoxybutyl)xanthen-9-yl]methyl]piperidine-3-carboxamide.
| Compound Name | ethanamine;1-fluoro-N-[[9-(4-methoxybutyl)xanthen-9-yl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 143321846 |
| Molecular Formula | C27H38FN3O3 |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | ethanamine;1-fluoro-N-[[9-(4-methoxybutyl)xanthen-9-yl]methyl]piperidine-3-carboxamide |
| SMILES | CCN.COCCCCC1(CNC(=O)C2CCCN(F)C2)c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C25H31FN2O3.C2H7N/c1-30-16-7-6-14-25(18-27-24(29)19-9-8-15-28(26)17-19)20-10-2-4-12-22(20)31-23-13-5-3-11-21(23)25;1-2-3/h2-5,10-13,19H,6-9,14-18H2,1H3,(H,27,29);2-3H2,1H3 |
| InChIKey | VUEPLONXUAXGKR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|