C32H35FN4O3S — CID 143321786
5-[(4-cyanophenyl)sulfanylamino]-1-fluoro-N-[[9-(4-methoxybutyl)xanthen-9-yl]methyl]piperidine-3-carboxamide (PubChem CID 143321786) has the molecular formula C32H35FN4O3S and a molecular weight of 574.72 g/mol. Its IUPAC name is 5-[(4-cyanophenyl)sulfanylamino]-1-fluoro-N-[[9-(4-methoxybutyl)xanthen-9-yl]methyl]piperidine-3-carboxamide.
| Compound Name | 5-[(4-cyanophenyl)sulfanylamino]-1-fluoro-N-[[9-(4-methoxybutyl)xanthen-9-yl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 143321786 |
| Molecular Formula | C32H35FN4O3S |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | 5-[(4-cyanophenyl)sulfanylamino]-1-fluoro-N-[[9-(4-methoxybutyl)xanthen-9-yl]methyl]piperidine-3-carboxamide |
| SMILES | COCCCCC1(CNC(=O)C2CC(NSc3ccc(C#N)cc3)CN(F)C2)c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C32H35FN4O3S/c1-39-17-7-6-16-32(27-8-2-4-10-29(27)40-30-11-5-3-9-28(30)32)22-35-31(38)24-18-25(21-37(33)20-24)36-41-26-14-12-23(19-34)13-15-26/h2-5,8-15,24-25,36H,6-7,16-18,20-22H2,1H3,(H,35,38) |
| InChIKey | AEBZLDIOCKBSTD-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|