C31H43N3O5 — CID 90687434
(3S,5R)-3-[[9-(4-methoxybutyl)xanthen-9-yl]methylcarbamoyl]-5-(3-methylbutylamino)piperidine-1-carboxylic acid (PubChem CID 90687434) has the molecular formula C31H43N3O5 and a molecular weight of 537.70 g/mol. Its IUPAC name is (3S,5R)-3-[[9-(4-methoxybutyl)xanthen-9-yl]methylcarbamoyl]-5-(3-methylbutylamino)piperidine-1-carboxylic acid.
| Compound Name | (3S,5R)-3-[[9-(4-methoxybutyl)xanthen-9-yl]methylcarbamoyl]-5-(3-methylbutylamino)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 90687434 |
| Molecular Formula | C31H43N3O5 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | (3S,5R)-3-[[9-(4-methoxybutyl)xanthen-9-yl]methylcarbamoyl]-5-(3-methylbutylamino)piperidine-1-carboxylic acid |
| SMILES | COCCCCC1(CNC(=O)[C@H]2C[C@@H](NCCC(C)C)CN(C(=O)O)C2)c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C31H43N3O5/c1-22(2)14-16-32-24-18-23(19-34(20-24)30(36)37)29(35)33-21-31(15-8-9-17-38-3)25-10-4-6-12-27(25)39-28-13-7-5-11-26(28)31/h4-7,10-13,22-24,32H,8-9,14-21H2,1-3H3,(H,33,35)(H,36,37)/t23-,24+/m0/s1 |
| InChIKey | KTCCZFLTCCAFFI-BJKOFHAPSA-N |
| XLogP | 5.02 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|