About (E)-2-ethyl-1,4-difluoro-N,N-dimethyl-3-methylidenepent-1-en-1-amine
(E)-2-ethyl-1,4-difluoro-N,N-dimethyl-3-methylidenepent-1-en-1-amine (PubChem CID 143325004) has the molecular formula C10H17F2N
and a molecular weight of 189.25 g/mol. Its IUPAC name is (E)-2-ethyl-1,4-difluoro-N,N-dimethyl-3-methylidenepent-1-en-1-amine.
Molecular Properties
| Compound Name | (E)-2-ethyl-1,4-difluoro-N,N-dimethyl-3-methylidenepent-1-en-1-amine |
| PubChem CID | 143325004 |
| Molecular Formula | C10H17F2N |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | (E)-2-ethyl-1,4-difluoro-N,N-dimethyl-3-methylidenepent-1-en-1-amine |
| SMILES | C=C(/C(CC)=C(/F)N(C)C)C(C)F |
| InChI | InChI=1S/C10H17F2N/c1-6-9(7(2)8(3)11)10(12)13(4)5/h8H,2,6H2,1,3-5H3/b10-9- |
| InChIKey | WZUDUQYUHNCAGE-KTKRTIGZSA-N |
| XLogP | 3.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-ethyl-1,4-difluoro-N,N-dimethyl-3-methylidenepent-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-ethyl-1,4-difluoro-N,N-dimethyl-3-methylidenepent-1-en-1-amine?
The IUPAC name of (E)-2-ethyl-1,4-difluoro-N,N-dimethyl-3-methylidenepent-1-en-1-amine (CID 143325004) is (E)-2-ethyl-1,4-difluoro-N,N-dimethyl-3-methylidenepent-1-en-1-amine.
What is the SMILES notation for (E)-2-ethyl-1,4-difluoro-N,N-dimethyl-3-methylidenepent-1-en-1-amine?
The canonical SMILES for (E)-2-ethyl-1,4-difluoro-N,N-dimethyl-3-methylidenepent-1-en-1-amine is C=C(/C(CC)=C(/F)N(C)C)C(C)F.
What is the InChIKey of (E)-2-ethyl-1,4-difluoro-N,N-dimethyl-3-methylidenepent-1-en-1-amine?
The InChIKey is WZUDUQYUHNCAGE-KTKRTIGZSA-N. The full InChI is InChI=1S/C10H17F2N/c1-6-9(7(2)8(3)11)10(12)13(4)5/h8H,2,6H2,1,3-5H3/b10-9-.
What are the key properties of (E)-2-ethyl-1,4-difluoro-N,N-dimethyl-3-methylidenepent-1-en-1-amine?
(E)-2-ethyl-1,4-difluoro-N,N-dimethyl-3-methylidenepent-1-en-1-amine has a molecular weight of 189.25 g/mol, XLogP of 3.05, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-ethyl-1,4-difluoro-N,N-dimethyl-3-methylidenepent-1-en-1-amine is sourced from PubChem (CID 143325004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).