C22H32FN5O — CID 143325536
4-ethyl-2-(5-fluoropyridine-2-carboximidoyl)aniline;N-[6-(methylamino)hexan-2-yl]formamide (PubChem CID 143325536) has the molecular formula C22H32FN5O and a molecular weight of 401.53 g/mol. Its IUPAC name is 4-ethyl-2-(5-fluoropyridine-2-carboximidoyl)aniline;N-[6-(methylamino)hexan-2-yl]formamide.
| Compound Name | 4-ethyl-2-(5-fluoropyridine-2-carboximidoyl)aniline;N-[6-(methylamino)hexan-2-yl]formamide |
|---|---|
| PubChem CID | 143325536 |
| Molecular Formula | C22H32FN5O |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | 4-ethyl-2-(5-fluoropyridine-2-carboximidoyl)aniline;N-[6-(methylamino)hexan-2-yl]formamide |
| SMILES | CNCCCCC(C)NC=O.[H]/N=C(\c1ccc(F)cn1)c1cc(CC)ccc1N |
| InChI | InChI=1S/C14H14FN3.C8H18N2O/c1-2-9-3-5-12(16)11(7-9)14(17)13-6-4-10(15)8-18-13;1-8(10-7-11)5-3-4-6-9-2/h3-8,17H,2,16H2,1H3;7-9H,3-6H2,1-2H3,(H,10,11)/b17-14-; |
| InChIKey | NUDSNPFROQTIPC-SBBUSYCLSA-N |
| XLogP | 3.29 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|