C9H16N2O — CID 143328533
ethane;N-[(1E,3Z)-4-(methylideneamino)buta-1,3-dienyl]acetamide (PubChem CID 143328533) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is ethane;N-[(1E,3Z)-4-(methylideneamino)buta-1,3-dienyl]acetamide.
| Compound Name | ethane;N-[(1E,3Z)-4-(methylideneamino)buta-1,3-dienyl]acetamide |
|---|---|
| PubChem CID | 143328533 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | ethane;N-[(1E,3Z)-4-(methylideneamino)buta-1,3-dienyl]acetamide |
| SMILES | C=N/C=C\C=C\NC(C)=O.CC |
| InChI | InChI=1S/C7H10N2O.C2H6/c1-7(10)9-6-4-3-5-8-2;1-2/h3-6H,2H2,1H3,(H,9,10);1-2H3/b5-3-,6-4+; |
| InChIKey | GAVKNWCXNKMHDS-HQWJOSOMSA-N |
| XLogP | 1.88 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|