C17H31NO — CID 143334986
(3Z,6Z)-deca-1,3,6-triene;(2S)-3-ethoxy-N-methylbut-3-en-2-amine (PubChem CID 143334986) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is (3Z,6Z)-deca-1,3,6-triene;(2S)-3-ethoxy-N-methylbut-3-en-2-amine.
| Compound Name | (3Z,6Z)-deca-1,3,6-triene;(2S)-3-ethoxy-N-methylbut-3-en-2-amine |
|---|---|
| PubChem CID | 143334986 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | (3Z,6Z)-deca-1,3,6-triene;(2S)-3-ethoxy-N-methylbut-3-en-2-amine |
| SMILES | C=C(OCC)[C@H](C)NC.C=C/C=C\C/C=C\CCC |
| InChI | InChI=1S/C10H16.C7H15NO/c1-3-5-7-9-10-8-6-4-2;1-5-9-7(3)6(2)8-4/h3,5,7-8,10H,1,4,6,9H2,2H3;6,8H,3,5H2,1-2,4H3/b7-5-,10-8-;/t;6-/m.0/s1 |
| InChIKey | XEYNMTLZUSYREV-BCIZKULYSA-N |
| XLogP | 4.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|