C11H20N2O — CID 143829892
1-N'-[(3E,5Z)-3-ethoxyhepta-3,5-dien-2-yl]ethene-1,1-diamine (PubChem CID 143829892) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-N'-[(3E,5Z)-3-ethoxyhepta-3,5-dien-2-yl]ethene-1,1-diamine.
| Compound Name | 1-N'-[(3E,5Z)-3-ethoxyhepta-3,5-dien-2-yl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 143829892 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-N'-[(3E,5Z)-3-ethoxyhepta-3,5-dien-2-yl]ethene-1,1-diamine |
| SMILES | C=C(N)NC(C)/C(=C\C=C/C)OCC |
| InChI | InChI=1S/C11H20N2O/c1-5-7-8-11(14-6-2)9(3)13-10(4)12/h5,7-9,13H,4,6,12H2,1-3H3/b7-5-,11-8+ |
| InChIKey | NFBSNICIPWLBKW-UKJSTWFMSA-N |
| XLogP | 1.89 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|