C36H29N3O3S3 — CID 143337211
(Z)-2-imino-4-[10-[1-(4-methylphenyl)-3,4-dihydro-2H-quinolin-6-yl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-3-(phenylcarbamoyl)pent-3-enoic acid (PubChem CID 143337211) has the molecular formula C36H29N3O3S3 and a molecular weight of 647.85 g/mol. Its IUPAC name is (Z)-2-imino-4-[10-[1-(4-methylphenyl)-3,4-dihydro-2H-quinolin-6-yl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-3-(phenylcarbamoyl)pent-3-enoic acid.
| Compound Name | (Z)-2-imino-4-[10-[1-(4-methylphenyl)-3,4-dihydro-2H-quinolin-6-yl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-3-(phenylcarbamoyl)pent-3-enoic acid |
|---|---|
| PubChem CID | 143337211 |
| Molecular Formula | C36H29N3O3S3 |
| Molecular Weight | 647.85 g/mol |
| Exact Mass | 647.14 |
| IUPAC Name | (Z)-2-imino-4-[10-[1-(4-methylphenyl)-3,4-dihydro-2H-quinolin-6-yl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-3-(phenylcarbamoyl)pent-3-enoic acid |
| SMILES | [H]/N=C(C(=O)O)/C(C(=O)Nc1ccccc1)=C(\C)c1cc2sc3cc(-c4ccc5c(c4)CCCN5c4ccc(C)cc4)sc3c2s1 |
| InChI | InChI=1S/C36H29N3O3S3/c1-20-10-13-25(14-11-20)39-16-6-7-22-17-23(12-15-26(22)39)28-19-30-34(45-28)33-29(43-30)18-27(44-33)21(2)31(32(37)36(41)42)35(40)38-24-8-4-3-5-9-24/h3-5,8-15,17-19,37H,6-7,16H2,1-2H3,(H,38,40)(H,41,42)/b31-21-,37-32- |
| InChIKey | GWZZNOGMSCYPJH-MSWVJDCZSA-N |
| XLogP | 9.75 |
| TPSA | 93.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.85 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|