C32H27N3O3 — CID 143337270
(Z)-2-imino-3-(phenylcarbamoyl)-4-[4-(1-phenyl-3,4-dihydro-2H-quinolin-6-yl)phenyl]but-3-enoic acid (PubChem CID 143337270) has the molecular formula C32H27N3O3 and a molecular weight of 501.59 g/mol. Its IUPAC name is (Z)-2-imino-3-(phenylcarbamoyl)-4-[4-(1-phenyl-3,4-dihydro-2H-quinolin-6-yl)phenyl]but-3-enoic acid.
| Compound Name | (Z)-2-imino-3-(phenylcarbamoyl)-4-[4-(1-phenyl-3,4-dihydro-2H-quinolin-6-yl)phenyl]but-3-enoic acid |
|---|---|
| PubChem CID | 143337270 |
| Molecular Formula | C32H27N3O3 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | (Z)-2-imino-3-(phenylcarbamoyl)-4-[4-(1-phenyl-3,4-dihydro-2H-quinolin-6-yl)phenyl]but-3-enoic acid |
| SMILES | [H]/N=C(C(=O)O)/C(=C/c1ccc(-c2ccc3c(c2)CCCN3c2ccccc2)cc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C32H27N3O3/c33-30(32(37)38)28(31(36)34-26-9-3-1-4-10-26)20-22-13-15-23(16-14-22)24-17-18-29-25(21-24)8-7-19-35(29)27-11-5-2-6-12-27/h1-6,9-18,20-21,33H,7-8,19H2,(H,34,36)(H,37,38)/b28-20-,33-30- |
| InChIKey | YYFYQGCJRUISLO-BUBLEDMASA-N |
| XLogP | 6.56 |
| TPSA | 93.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|