C39H46N4O3 — CID 143337325
ethane;(3Z,5E)-6-[1-[4-(ethylamino)phenyl]-3,4-dihydro-2H-quinolin-6-yl]-2-imino-3-(phenylcarbamoyl)hexa-3,5-dienoic acid;(3Z,5Z)-hepta-1,3,5-triene (PubChem CID 143337325) has the molecular formula C39H46N4O3 and a molecular weight of 618.82 g/mol. Its IUPAC name is ethane;(3Z,5E)-6-[1-[4-(ethylamino)phenyl]-3,4-dihydro-2H-quinolin-6-yl]-2-imino-3-(phenylcarbamoyl)hexa-3,5-dienoic acid;(3Z,5Z)-hepta-1,3,5-triene.
| Compound Name | ethane;(3Z,5E)-6-[1-[4-(ethylamino)phenyl]-3,4-dihydro-2H-quinolin-6-yl]-2-imino-3-(phenylcarbamoyl)hexa-3,5-dienoic acid;(3Z,5Z)-hepta-1,3,5-triene |
|---|---|
| PubChem CID | 143337325 |
| Molecular Formula | C39H46N4O3 |
| Molecular Weight | 618.82 g/mol |
| Exact Mass | 618.36 |
| IUPAC Name | ethane;(3Z,5E)-6-[1-[4-(ethylamino)phenyl]-3,4-dihydro-2H-quinolin-6-yl]-2-imino-3-(phenylcarbamoyl)hexa-3,5-dienoic acid;(3Z,5Z)-hepta-1,3,5-triene |
| SMILES | C=C/C=C\C=C/C.CC.[H]/N=C(C(=O)O)/C(=C/C=C/c1ccc2c(c1)CCCN2c1ccc(NCC)cc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C30H30N4O3.C7H10.C2H6/c1-2-32-23-14-16-25(17-15-23)34-19-7-9-22-20-21(13-18-27(22)34)8-6-12-26(28(31)30(36)37)29(35)33-24-10-4-3-5-11-24;1-3-5-7-6-4-2;1-2/h3-6,8,10-18,20,31-32H,2,7,9,19H2,1H3,(H,33,35)(H,36,37);3-7H,1H2,2H3;1-2H3/b8-6+,26-12-,31-28-;6-4-,7-5-; |
| InChIKey | FRJBEVXTTDFRMY-WHXWDVMHSA-N |
| XLogP | 9.22 |
| TPSA | 105.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.82 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|