C31H32N4O3 — CID 143337355
(2Z)-2-[(E)-3-(1-benzyl-2,3-dihydroindol-5-yl)prop-2-enylidene]-3-imino-N'-oxo-N-phenylbutanediamide;propane (PubChem CID 143337355) has the molecular formula C31H32N4O3 and a molecular weight of 508.62 g/mol. Its IUPAC name is (2Z)-2-[(E)-3-(1-benzyl-2,3-dihydroindol-5-yl)prop-2-enylidene]-3-imino-N'-oxo-N-phenylbutanediamide;propane.
| Compound Name | (2Z)-2-[(E)-3-(1-benzyl-2,3-dihydroindol-5-yl)prop-2-enylidene]-3-imino-N'-oxo-N-phenylbutanediamide;propane |
|---|---|
| PubChem CID | 143337355 |
| Molecular Formula | C31H32N4O3 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | (2Z)-2-[(E)-3-(1-benzyl-2,3-dihydroindol-5-yl)prop-2-enylidene]-3-imino-N'-oxo-N-phenylbutanediamide;propane |
| SMILES | CCC.[H]/N=C(C(=O)N=O)/C(=C/C=C/c1ccc2c(c1)CCN2Cc1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C28H24N4O3.C3H8/c29-26(28(34)31-35)24(27(33)30-23-11-5-2-6-12-23)13-7-10-20-14-15-25-22(18-20)16-17-32(25)19-21-8-3-1-4-9-21;1-3-2/h1-15,18,29H,16-17,19H2,(H,30,33);3H2,1-2H3/b10-7+,24-13-,29-26-; |
| InChIKey | KPWJTGZZPLOCKB-DPDDOAMWSA-N |
| XLogP | 6.56 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|