About N-[3-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-4-phenylbenzenesulfinamide
N-[3-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-4-phenylbenzenesulfinamide (PubChem CID 176928082) has the molecular formula C27H24N2OS
and a molecular weight of 424.57 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-4-phenylbenzenesulfinamide.
Molecular Properties
| Compound Name | N-[3-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-4-phenylbenzenesulfinamide |
| PubChem CID | 176928082 |
| Molecular Formula | C27H24N2OS |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-[3-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-4-phenylbenzenesulfinamide |
| SMILES | O=S(Nc1cccc(N2CCCc3ccccc32)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H24N2OS/c30-31(26-17-15-22(16-18-26)21-8-2-1-3-9-21)28-24-12-6-13-25(20-24)29-19-7-11-23-10-4-5-14-27(23)29/h1-6,8-10,12-18,20,28H,7,11,19H2 |
| InChIKey | RIDPMGSDSBVNHF-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[3-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-4-phenylbenzenesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-4-phenylbenzenesulfinamide?
The IUPAC name of N-[3-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-4-phenylbenzenesulfinamide (CID 176928082) is N-[3-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-4-phenylbenzenesulfinamide.
What is the SMILES notation for N-[3-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-4-phenylbenzenesulfinamide?
The canonical SMILES for N-[3-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-4-phenylbenzenesulfinamide is O=S(Nc1cccc(N2CCCc3ccccc32)c1)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of N-[3-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-4-phenylbenzenesulfinamide?
The InChIKey is RIDPMGSDSBVNHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24N2OS/c30-31(26-17-15-22(16-18-26)21-8-2-1-3-9-21)28-24-12-6-13-25(20-24)29-19-7-11-23-10-4-5-14-27(23)29/h1-6,8-10,12-18,20,28H,7,11,19H2.
What are the key properties of N-[3-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-4-phenylbenzenesulfinamide?
N-[3-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-4-phenylbenzenesulfinamide has a molecular weight of 424.57 g/mol, XLogP of 6.57, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(3,4-dihydro-2H-quinolin-1-yl)phenyl]-4-phenylbenzenesulfinamide is sourced from PubChem (CID 176928082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).