C22H19F3N2S — CID 176928135
3-(3,4-dihydro-2H-quinolin-1-yl)-N-[4-(trifluoromethyl)phenyl]sulfanylaniline (PubChem CID 176928135) has the molecular formula C22H19F3N2S and a molecular weight of 400.47 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-quinolin-1-yl)-N-[4-(trifluoromethyl)phenyl]sulfanylaniline.
| Compound Name | 3-(3,4-dihydro-2H-quinolin-1-yl)-N-[4-(trifluoromethyl)phenyl]sulfanylaniline |
|---|---|
| PubChem CID | 176928135 |
| Molecular Formula | C22H19F3N2S |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 3-(3,4-dihydro-2H-quinolin-1-yl)-N-[4-(trifluoromethyl)phenyl]sulfanylaniline |
| SMILES | FC(F)(F)c1ccc(SNc2cccc(N3CCCc4ccccc43)c2)cc1 |
| InChI | InChI=1S/C22H19F3N2S/c23-22(24,25)17-10-12-20(13-11-17)28-26-18-7-3-8-19(15-18)27-14-4-6-16-5-1-2-9-21(16)27/h1-3,5,7-13,15,26H,4,6,14H2 |
| InChIKey | FJMOYUONLSIVKG-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|