C29H31N3O4 — CID 143340904
2-[2-(3,4-dimethoxyphenyl)ethoxy]-6-phenoxy-4-piperidin-1-ylquinazoline (PubChem CID 143340904) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethoxy]-6-phenoxy-4-piperidin-1-ylquinazoline.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethoxy]-6-phenoxy-4-piperidin-1-ylquinazoline |
|---|---|
| PubChem CID | 143340904 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethoxy]-6-phenoxy-4-piperidin-1-ylquinazoline |
| SMILES | COc1ccc(CCOc2nc(N3CCCCC3)c3cc(Oc4ccccc4)ccc3n2)cc1OC |
| InChI | InChI=1S/C29H31N3O4/c1-33-26-14-11-21(19-27(26)34-2)15-18-35-29-30-25-13-12-23(36-22-9-5-3-6-10-22)20-24(25)28(31-29)32-16-7-4-8-17-32/h3,5-6,9-14,19-20H,4,7-8,15-18H2,1-2H3 |
| InChIKey | DLRDUUUCXINRMI-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 65.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |