C12H21FN2 — CID 143341963
1-N-[(Z)-2-fluoropent-2-en-3-yl]-2,3-dimethylidenepentane-1,4-diamine (PubChem CID 143341963) has the molecular formula C12H21FN2 and a molecular weight of 212.31 g/mol. Its IUPAC name is 1-N-[(Z)-2-fluoropent-2-en-3-yl]-2,3-dimethylidenepentane-1,4-diamine.
| Compound Name | 1-N-[(Z)-2-fluoropent-2-en-3-yl]-2,3-dimethylidenepentane-1,4-diamine |
|---|---|
| PubChem CID | 143341963 |
| Molecular Formula | C12H21FN2 |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.17 |
| IUPAC Name | 1-N-[(Z)-2-fluoropent-2-en-3-yl]-2,3-dimethylidenepentane-1,4-diamine |
| SMILES | C=C(CN/C(CC)=C(/C)F)C(=C)C(C)N |
| InChI | InChI=1S/C12H21FN2/c1-6-12(10(4)13)15-7-8(2)9(3)11(5)14/h11,15H,2-3,6-7,14H2,1,4-5H3/b12-10- |
| InChIKey | GNUPKFMYJRKSBX-BENRWUELSA-N |
| XLogP | 2.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|