C31H34FN5O4 — CID 143342346
prop-2-enyl (1S)-1-[[8-ethyl-7-[(4-fluorophenyl)methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyridine-5-carbonyl]amino]-4-methylidene-1,2,3,3a,5,6,7,7a-octahydroindene-5-carboxylate (PubChem CID 143342346) has the molecular formula C31H34FN5O4 and a molecular weight of 559.64 g/mol. Its IUPAC name is prop-2-enyl (1S)-1-[[8-ethyl-7-[(4-fluorophenyl)methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyridine-5-carbonyl]amino]-4-methylidene-1,2,3,3a,5,6,7,7a-octahydroindene-5-carboxylate.
| Compound Name | prop-2-enyl (1S)-1-[[8-ethyl-7-[(4-fluorophenyl)methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyridine-5-carbonyl]amino]-4-methylidene-1,2,3,3a,5,6,7,7a-octahydroindene-5-carboxylate |
|---|---|
| PubChem CID | 143342346 |
| Molecular Formula | C31H34FN5O4 |
| Molecular Weight | 559.64 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | prop-2-enyl (1S)-1-[[8-ethyl-7-[(4-fluorophenyl)methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyridine-5-carbonyl]amino]-4-methylidene-1,2,3,3a,5,6,7,7a-octahydroindene-5-carboxylate |
| SMILES | C=CCOC(=O)C1CCC2C(CC[C@@H]2NC(=O)c2cc(C(=O)NCc3ccc(F)cc3)c(CC)c3ncnn23)C1=C |
| InChI | InChI=1S/C31H34FN5O4/c1-4-14-41-31(40)23-10-11-24-22(18(23)3)12-13-26(24)36-30(39)27-15-25(21(5-2)28-34-17-35-37(27)28)29(38)33-16-19-6-8-20(32)9-7-19/h4,6-9,15,17,22-24,26H,1,3,5,10-14,16H2,2H3,(H,33,38)(H,36,39)/t22?,23?,24?,26-/m0/s1 |
| InChIKey | VGLATDJGXZHENH-WCINTBDISA-N |
| XLogP | 4.18 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.64 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|