C9H11F3S — CID 143342423
(3Z,5E)-7,7,7-trifluoro-6-methyl-2-methylidenehepta-3,5-diene-1-thiol (PubChem CID 143342423) has the molecular formula C9H11F3S and a molecular weight of 208.25 g/mol. Its IUPAC name is (3Z,5E)-7,7,7-trifluoro-6-methyl-2-methylidenehepta-3,5-diene-1-thiol.
| Compound Name | (3Z,5E)-7,7,7-trifluoro-6-methyl-2-methylidenehepta-3,5-diene-1-thiol |
|---|---|
| PubChem CID | 143342423 |
| Molecular Formula | C9H11F3S |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | (3Z,5E)-7,7,7-trifluoro-6-methyl-2-methylidenehepta-3,5-diene-1-thiol |
| SMILES | C=C(/C=C\C=C(/C)C(F)(F)F)CS |
| InChI | InChI=1S/C9H11F3S/c1-7(6-13)4-3-5-8(2)9(10,11)12/h3-5,13H,1,6H2,2H3/b4-3-,8-5+ |
| InChIKey | STVFMCKMDXANTP-HMRFFJRGSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|