C28H39N5 — CID 143342646
N'-ethyl-N-[(6E)-4-methylidene-2-[(2-methylidene-1,3,4,7-tetrahydrocyclohepta[b]pyridin-8-yl)methylamino]-7-[[(E)-pent-2-enyl]amino]hepta-1,6-dien-3-ylidene]methanimidamide (PubChem CID 143342646) has the molecular formula C28H39N5 and a molecular weight of 445.66 g/mol. Its IUPAC name is N'-ethyl-N-[(6E)-4-methylidene-2-[(2-methylidene-1,3,4,7-tetrahydrocyclohepta[b]pyridin-8-yl)methylamino]-7-[[(E)-pent-2-enyl]amino]hepta-1,6-dien-3-ylidene]methanimidamide.
| Compound Name | N'-ethyl-N-[(6E)-4-methylidene-2-[(2-methylidene-1,3,4,7-tetrahydrocyclohepta[b]pyridin-8-yl)methylamino]-7-[[(E)-pent-2-enyl]amino]hepta-1,6-dien-3-ylidene]methanimidamide |
|---|---|
| PubChem CID | 143342646 |
| Molecular Formula | C28H39N5 |
| Molecular Weight | 445.66 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | N'-ethyl-N-[(6E)-4-methylidene-2-[(2-methylidene-1,3,4,7-tetrahydrocyclohepta[b]pyridin-8-yl)methylamino]-7-[[(E)-pent-2-enyl]amino]hepta-1,6-dien-3-ylidene]methanimidamide |
| SMILES | C=C1CCC2=C(C=C(CNC(=C)/C(=N/C=N/CC)C(=C)C/C=C/NC/C=C/CC)CC=C2)N1 |
| InChI | InChI=1S/C28H39N5/c1-6-8-9-17-30-18-11-12-22(3)28(32-21-29-7-2)24(5)31-20-25-13-10-14-26-16-15-23(4)33-27(26)19-25/h8-11,14,18-19,21,30-31,33H,3-7,12-13,15-17,20H2,1-2H3/b9-8+,18-11+,29-21+,32-28+ |
| InChIKey | YXDSGHMCVFJKOQ-KCOGSUAKSA-N |
| XLogP | 5.63 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.66 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|