C12H18O2 — CID 143346785
2-[(3E,6E)-7-methylnona-1,3,6-trien-3-yl]oxyacetaldehyde (PubChem CID 143346785) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 2-[(3E,6E)-7-methylnona-1,3,6-trien-3-yl]oxyacetaldehyde.
| Compound Name | 2-[(3E,6E)-7-methylnona-1,3,6-trien-3-yl]oxyacetaldehyde |
|---|---|
| PubChem CID | 143346785 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2-[(3E,6E)-7-methylnona-1,3,6-trien-3-yl]oxyacetaldehyde |
| SMILES | C=C/C(=C\C/C=C(\C)CC)OCC=O |
| InChI | InChI=1S/C12H18O2/c1-4-11(3)7-6-8-12(5-2)14-10-9-13/h5,7-9H,2,4,6,10H2,1,3H3/b11-7+,12-8+ |
| InChIKey | SINYOIHBDVOKSB-MKICQXMISA-N |
| XLogP | 3.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|