C15H22BrN5OS — CID 143349549
(Z)-5-bromo-3-hydroxy-N-[6-(piperazin-1-ylmethyl)-2-pyridinyl]-1,3-thiazol-2-imine;ethane (PubChem CID 143349549) has the molecular formula C15H22BrN5OS and a molecular weight of 400.35 g/mol. Its IUPAC name is (Z)-5-bromo-3-hydroxy-N-[6-(piperazin-1-ylmethyl)-2-pyridinyl]-1,3-thiazol-2-imine;ethane.
| Compound Name | (Z)-5-bromo-3-hydroxy-N-[6-(piperazin-1-ylmethyl)-2-pyridinyl]-1,3-thiazol-2-imine;ethane |
|---|---|
| PubChem CID | 143349549 |
| Molecular Formula | C15H22BrN5OS |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | (Z)-5-bromo-3-hydroxy-N-[6-(piperazin-1-ylmethyl)-2-pyridinyl]-1,3-thiazol-2-imine;ethane |
| SMILES | CC.On1cc(Br)s/c1=N\c1cccc(CN2CCNCC2)n1 |
| InChI | InChI=1S/C13H16BrN5OS.C2H6/c14-11-9-19(20)13(21-11)17-12-3-1-2-10(16-12)8-18-6-4-15-5-7-18;1-2/h1-3,9,15,20H,4-8H2;1-2H3/b17-13-; |
| InChIKey | AAXANNURVNQJPA-VSORCOHTSA-N |
| XLogP | 2.61 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|