About dibromocobalt;1-[[6-(piperazin-1-ylmethyl)-2-pyridinyl]methyl]piperazine
dibromocobalt;1-[[6-(piperazin-1-ylmethyl)-2-pyridinyl]methyl]piperazine (PubChem CID 154596524) has the molecular formula C15H25Br2CoN5
and a molecular weight of 494.14 g/mol. Its IUPAC name is dibromocobalt;1-[[6-(piperazin-1-ylmethyl)-2-pyridinyl]methyl]piperazine.
Molecular Properties
| Compound Name | dibromocobalt;1-[[6-(piperazin-1-ylmethyl)-2-pyridinyl]methyl]piperazine |
| PubChem CID | 154596524 |
| Molecular Formula | C15H25Br2CoN5 |
| Molecular Weight | 494.14 g/mol |
| Exact Mass | 491.98 |
| IUPAC Name | dibromocobalt;1-[[6-(piperazin-1-ylmethyl)-2-pyridinyl]methyl]piperazine |
| SMILES | Br[Co]Br.c1cc(CN2CCNCC2)nc(CN2CCNCC2)c1 |
| InChI | InChI=1S/C15H25N5.2BrH.Co/c1-2-14(12-19-8-4-16-5-9-19)18-15(3-1)13-20-10-6-17-7-11-20;;;/h1-3,16-17H,4-13H2;2*1H;/q;;;+2/p-2 |
| InChIKey | AELNZCXDWLWPHO-UHFFFAOYSA-L |
| XLogP | 1.58 |
| TPSA | 43.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 494.14 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dibromocobalt;1-[[6-(piperazin-1-ylmethyl)-2-pyridinyl]methyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibromocobalt;1-[[6-(piperazin-1-ylmethyl)-2-pyridinyl]methyl]piperazine?
The IUPAC name of dibromocobalt;1-[[6-(piperazin-1-ylmethyl)-2-pyridinyl]methyl]piperazine (CID 154596524) is dibromocobalt;1-[[6-(piperazin-1-ylmethyl)-2-pyridinyl]methyl]piperazine.
What is the SMILES notation for dibromocobalt;1-[[6-(piperazin-1-ylmethyl)-2-pyridinyl]methyl]piperazine?
The canonical SMILES for dibromocobalt;1-[[6-(piperazin-1-ylmethyl)-2-pyridinyl]methyl]piperazine is Br[Co]Br.c1cc(CN2CCNCC2)nc(CN2CCNCC2)c1.
What is the InChIKey of dibromocobalt;1-[[6-(piperazin-1-ylmethyl)-2-pyridinyl]methyl]piperazine?
The InChIKey is AELNZCXDWLWPHO-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H25N5.2BrH.Co/c1-2-14(12-19-8-4-16-5-9-19)18-15(3-1)13-20-10-6-17-7-11-20;;;/h1-3,16-17H,4-13H2;2*1H;/q;;;+2/p-2.
What are the key properties of dibromocobalt;1-[[6-(piperazin-1-ylmethyl)-2-pyridinyl]methyl]piperazine?
dibromocobalt;1-[[6-(piperazin-1-ylmethyl)-2-pyridinyl]methyl]piperazine has a molecular weight of 494.14 g/mol, XLogP of 1.58, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dibromocobalt;1-[[6-(piperazin-1-ylmethyl)-2-pyridinyl]methyl]piperazine is sourced from PubChem (CID 154596524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).