C20H40N2O4 — CID 143352631
N-butyl-N-methylpropanamide;(Z)-2-(hydroxymethylamino)-3-methyldec-4-enoic acid (PubChem CID 143352631) has the molecular formula C20H40N2O4 and a molecular weight of 372.55 g/mol. Its IUPAC name is N-butyl-N-methylpropanamide;(Z)-2-(hydroxymethylamino)-3-methyldec-4-enoic acid.
| Compound Name | N-butyl-N-methylpropanamide;(Z)-2-(hydroxymethylamino)-3-methyldec-4-enoic acid |
|---|---|
| PubChem CID | 143352631 |
| Molecular Formula | C20H40N2O4 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | N-butyl-N-methylpropanamide;(Z)-2-(hydroxymethylamino)-3-methyldec-4-enoic acid |
| SMILES | CCCCC/C=C\C(C)C(NCO)C(=O)O.CCCCN(C)C(=O)CC |
| InChI | InChI=1S/C12H23NO3.C8H17NO/c1-3-4-5-6-7-8-10(2)11(12(15)16)13-9-14;1-4-6-7-9(3)8(10)5-2/h7-8,10-11,13-14H,3-6,9H2,1-2H3,(H,15,16);4-7H2,1-3H3/b8-7-; |
| InChIKey | UMAUZWQDDXLUAT-CFYXSCKTSA-N |
| XLogP | 3.41 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|