C19H36N2O3 — CID 143056076
(Z)-3-methyl-2-[2-[(2S)-1-methylpyrrolidin-2-yl]ethoxymethylamino]dec-4-enoic acid (PubChem CID 143056076) has the molecular formula C19H36N2O3 and a molecular weight of 340.51 g/mol. Its IUPAC name is (Z)-3-methyl-2-[2-[(2S)-1-methylpyrrolidin-2-yl]ethoxymethylamino]dec-4-enoic acid.
| Compound Name | (Z)-3-methyl-2-[2-[(2S)-1-methylpyrrolidin-2-yl]ethoxymethylamino]dec-4-enoic acid |
|---|---|
| PubChem CID | 143056076 |
| Molecular Formula | C19H36N2O3 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.27 |
| IUPAC Name | (Z)-3-methyl-2-[2-[(2S)-1-methylpyrrolidin-2-yl]ethoxymethylamino]dec-4-enoic acid |
| SMILES | CCCCC/C=C\C(C)C(NCOCC[C@@H]1CCCN1C)C(=O)O |
| InChI | InChI=1S/C19H36N2O3/c1-4-5-6-7-8-10-16(2)18(19(22)23)20-15-24-14-12-17-11-9-13-21(17)3/h8,10,16-18,20H,4-7,9,11-15H2,1-3H3,(H,22,23)/b10-8-/t16?,17-,18?/m0/s1 |
| InChIKey | OTRUPALOZMBBJG-VGSABAFESA-N |
| XLogP | 3.26 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|