C36H67NO3 — CID 121330970
[3-methyl-1-(1-methylpyrrolidin-2-yl)nonacosa-20,23-dien-12-yl] hydrogen carbonate (PubChem CID 121330970) has the molecular formula C36H67NO3 and a molecular weight of 561.94 g/mol. Its IUPAC name is [3-methyl-1-(1-methylpyrrolidin-2-yl)nonacosa-20,23-dien-12-yl] hydrogen carbonate.
| Compound Name | [3-methyl-1-(1-methylpyrrolidin-2-yl)nonacosa-20,23-dien-12-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 121330970 |
| Molecular Formula | C36H67NO3 |
| Molecular Weight | 561.94 g/mol |
| Exact Mass | 561.51 |
| IUPAC Name | [3-methyl-1-(1-methylpyrrolidin-2-yl)nonacosa-20,23-dien-12-yl] hydrogen carbonate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(CCCCCCCCC(C)CCC1CCCN1C)OC(=O)O |
| InChI | InChI=1S/C36H67NO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-20-23-28-35(40-36(38)39)29-24-21-18-17-19-22-26-33(2)30-31-34-27-25-32-37(34)3/h8-9,11-12,33-35H,4-7,10,13-32H2,1-3H3,(H,38,39) |
| InChIKey | LDMSFIVIBMILIO-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.94 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|