C27H50N2O — CID 143352811
2,2-dimethyl-6-[1-[[(8S)-2,2,8-trimethyl-4-methylidene-6-prop-1-en-2-yldecan-3-yl]amino]ethenylamino]hexan-3-one (PubChem CID 143352811) has the molecular formula C27H50N2O and a molecular weight of 418.71 g/mol. Its IUPAC name is 2,2-dimethyl-6-[1-[[(8S)-2,2,8-trimethyl-4-methylidene-6-prop-1-en-2-yldecan-3-yl]amino]ethenylamino]hexan-3-one.
| Compound Name | 2,2-dimethyl-6-[1-[[(8S)-2,2,8-trimethyl-4-methylidene-6-prop-1-en-2-yldecan-3-yl]amino]ethenylamino]hexan-3-one |
|---|---|
| PubChem CID | 143352811 |
| Molecular Formula | C27H50N2O |
| Molecular Weight | 418.71 g/mol |
| Exact Mass | 418.39 |
| IUPAC Name | 2,2-dimethyl-6-[1-[[(8S)-2,2,8-trimethyl-4-methylidene-6-prop-1-en-2-yldecan-3-yl]amino]ethenylamino]hexan-3-one |
| SMILES | C=C(NCCCC(=O)C(C)(C)C)NC(C(=C)CC(C[C@@H](C)CC)C(=C)C)C(C)(C)C |
| InChI | InChI=1S/C27H50N2O/c1-13-20(4)17-23(19(2)3)18-21(5)25(27(10,11)12)29-22(6)28-16-14-15-24(30)26(7,8)9/h20,23,25,28-29H,2,5-6,13-18H2,1,3-4,7-12H3/t20-,23?,25?/m0/s1 |
| InChIKey | YRJLUDOPQDHADR-UPDUBSDMSA-N |
| XLogP | 7.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.71 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|