C17H30N4O4 — CID 143354157
1-(2-aminoacetyl)-N-(1-amino-5-methyl-1,2-dioxooctan-3-yl)-3-methylpyrrolidine-2-carboxamide (PubChem CID 143354157) has the molecular formula C17H30N4O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-(2-aminoacetyl)-N-(1-amino-5-methyl-1,2-dioxooctan-3-yl)-3-methylpyrrolidine-2-carboxamide.
| Compound Name | 1-(2-aminoacetyl)-N-(1-amino-5-methyl-1,2-dioxooctan-3-yl)-3-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143354157 |
| Molecular Formula | C17H30N4O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 1-(2-aminoacetyl)-N-(1-amino-5-methyl-1,2-dioxooctan-3-yl)-3-methylpyrrolidine-2-carboxamide |
| SMILES | CCCC(C)CC(NC(=O)C1C(C)CCN1C(=O)CN)C(=O)C(N)=O |
| InChI | InChI=1S/C17H30N4O4/c1-4-5-10(2)8-12(15(23)16(19)24)20-17(25)14-11(3)6-7-21(14)13(22)9-18/h10-12,14H,4-9,18H2,1-3H3,(H2,19,24)(H,20,25) |
| InChIKey | KGTDLQYBZVKTPU-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|