C21H19N3O3S2 — CID 143364158
[3-methylidene-1-[6-(thiophen-2-ylsulfonylmethyl)-9H-pyrido[2,3-b]indol-4-yl]azetidin-2-yl]methanol (PubChem CID 143364158) has the molecular formula C21H19N3O3S2 and a molecular weight of 425.54 g/mol. Its IUPAC name is [3-methylidene-1-[6-(thiophen-2-ylsulfonylmethyl)-9H-pyrido[2,3-b]indol-4-yl]azetidin-2-yl]methanol.
| Compound Name | [3-methylidene-1-[6-(thiophen-2-ylsulfonylmethyl)-9H-pyrido[2,3-b]indol-4-yl]azetidin-2-yl]methanol |
|---|---|
| PubChem CID | 143364158 |
| Molecular Formula | C21H19N3O3S2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | [3-methylidene-1-[6-(thiophen-2-ylsulfonylmethyl)-9H-pyrido[2,3-b]indol-4-yl]azetidin-2-yl]methanol |
| SMILES | C=C1CN(c2ccnc3[nH]c4ccc(CS(=O)(=O)c5cccs5)cc4c23)C1CO |
| InChI | InChI=1S/C21H19N3O3S2/c1-13-10-24(18(13)11-25)17-6-7-22-21-20(17)15-9-14(4-5-16(15)23-21)12-29(26,27)19-3-2-8-28-19/h2-9,18,25H,1,10-12H2,(H,22,23) |
| InChIKey | GDRDLSPSTUKHDQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|